Products 727704-69-0
CAS 727704-69-0 is the registry number for Ethyl 5-(2-chloropropanoyl)-2,4-dimethyl-1h-pyrrole-3-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Ethyl 5-(2-chloropropanoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate (CAS 727704-69-0) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: ethyl 5-(2-chloropropanoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate. InChIKey: JVNGIXTYBDQIED-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO3 |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | ethyl 5-(2-chloropropanoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| InChIKey | JVNGIXTYBDQIED-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C1C)C(=O)C(C)Cl)C |
Computed by PubChem (NCBI)