CAS 72793-46-5 is the registry number for Phenobarbital-d5. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
5-ethyl-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-diazinane-2,4,6-trione (CAS 72793-46-5) is a chemical compound with the molecular formula C12H12N2O3 and a molecular weight of 237.27 g/mol. IUPAC name: 5-ethyl-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-diazinane-2,4,6-trione. InChIKey: DDBREPKUVSBGFI-DKFMXDSJSA-N.
| Molecular formula | C12H12N2O3 |
|---|---|
| Molecular weight | 237.27 g/mol |
| IUPAC name | 5-ethyl-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-diazinane-2,4,6-trione |
| InChIKey | DDBREPKUVSBGFI-DKFMXDSJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2(C(=O)NC(=O)NC2=O)CC)[2H])[2H] |
Computed by PubChem (NCBI)