CAS 72796-33-9 is the registry number for 4,5-Dichloro-2-phenyl-1h-imidazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g, 250mg.
4,5-dichloro-2-phenyl-1H-imidazole (CAS 72796-33-9) is a chemical compound with the molecular formula C9H6Cl2N2 and a molecular weight of 213.06 g/mol. IUPAC name: 4,5-dichloro-2-phenyl-1H-imidazole. InChIKey: NPJFZCVZBMLFIR-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2 |
|---|---|
| Molecular weight | 213.06 g/mol |
| IUPAC name | 4,5-dichloro-2-phenyl-1H-imidazole |
| InChIKey | NPJFZCVZBMLFIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=C(N2)Cl)Cl |
Computed by PubChem (NCBI)