CAS 72802-25-6 appears in our catalog under these names: 1-(3-Fluoro-4-nitrophenyl)ethanone 95%, 1-(3-Fluoro-4-nitrophenyl)ethanone, 98%, 98%, 1-(3-Fluoro-4-nitrophenyl)ethanone, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 100mg, 10g, 50g.
1-(3-fluoro-4-nitrophenyl)ethanone (CAS 72802-25-6) is a chemical compound with the molecular formula C8H6FNO3 and a molecular weight of 183.14 g/mol. IUPAC name: 1-(3-fluoro-4-nitrophenyl)ethanone. InChIKey: UHAATBAYLFRWMR-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO3 |
|---|---|
| Molecular weight | 183.14 g/mol |
| IUPAC name | 1-(3-fluoro-4-nitrophenyl)ethanone |
| InChIKey | UHAATBAYLFRWMR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)