CAS 72804-94-5 appears in our catalog under these names: 2-Methyl-8-(1-methylethyl)quinoline, 98%, 98%, 2-METHYL-8-(PROPAN-2-YL)QUINOLINE. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
2-methyl-8-propan-2-ylquinoline (CAS 72804-94-5) is a chemical compound with the molecular formula C13H15N and a molecular weight of 185.26 g/mol. IUPAC name: 2-methyl-8-propan-2-ylquinoline. InChIKey: SFUDEEQGHVKELS-UHFFFAOYSA-N.
| Molecular formula | C13H15N |
|---|---|
| Molecular weight | 185.26 g/mol |
| IUPAC name | 2-methyl-8-propan-2-ylquinoline |
| InChIKey | SFUDEEQGHVKELS-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC=C2C(C)C)C=C1 |
Computed by PubChem (NCBI)