CAS 728864-60-6 appears in our catalog under these names: 2,6-Dimethylimidazo(1,2-a)pyridine-3-carbaldehyde, 95+%, 2,6-Dimethyl-imidazo[1,2-a]pyridine-3-carbaldehyde. Offered by: AmBeed, Fluorochem. Available pack sizes: 250mg, 50mg, 100mg.
2,6-dimethylimidazo[1,2-a]pyridine-3-carbaldehyde (CAS 728864-60-6) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 2,6-dimethylimidazo[1,2-a]pyridine-3-carbaldehyde. InChIKey: LXBYSLXINCYUQH-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 2,6-dimethylimidazo[1,2-a]pyridine-3-carbaldehyde |
| InChIKey | LXBYSLXINCYUQH-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=NC(=C2C=O)C)C=C1 |
Computed by PubChem (NCBI)