CAS 729613-71-2 appears in our catalog under these names: 6,7,8,9-Tetrahydro-5H-carbazole-2-carboxylic acid, 95%, 2,3,4,9-Tetrahydro-1h-carbazole-7-carboxylic acid, 95%, 2,3,4,9-Tetrahydro-1H-carbazole-7-carboxylic acid 95%, 2,3,4,9-Tetrahydro-1H-carbazole-7-carboxylic acid, 95%, 95%. Offered by: Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid (CAS 729613-71-2) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid. InChIKey: PCWDMUSCUJPFII-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid |
| InChIKey | PCWDMUSCUJPFII-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(N2)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)