Products 73013-51-1
CAS 73013-51-1 appears in our catalog under these names: Ethyl 4-(2-oxopropyl)benzoate, 95%, Ethyl 4-(2-oxopropyl)benzoate, 95+%, Ethyl 4-(2-oxopropyl)benzoate, 97%, 97%, Ethyl 4-(2-oxopropyl)benzoate, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 250mg, 100mg, 50mg.
Ethyl 4-(2-oxopropyl)benzoate (CAS 73013-51-1) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: ethyl 4-(2-oxopropyl)benzoate. InChIKey: RJNSZJDYXNBUEF-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | ethyl 4-(2-oxopropyl)benzoate |
| InChIKey | RJNSZJDYXNBUEF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)CC(=O)C |
Computed by PubChem (NCBI)