CAS 73024-74-5 is the registry number for 2-Acetamido-1,3,6-tri-O-acetyl-2-deoxy-a-D-glucopyranose. Offered by: Biosynth. Available pack sizes: 5mg, 2mg.
[(3S,4S,6R)-5-acetamido-4,6-diacetyloxy-3-hydroxyoxan-2-yl]methyl acetate (CAS 73024-74-5) is a chemical compound with the molecular formula C14H21NO9 and a molecular weight of 347.32 g/mol. IUPAC name: [(3S,4S,6R)-5-acetamido-4,6-diacetyloxy-3-hydroxyoxan-2-yl]methyl acetate. InChIKey: RCYLXESGSHGRBI-LSUUEXMVSA-N.
| Molecular formula | C14H21NO9 |
|---|---|
| Molecular weight | 347.32 g/mol |
| IUPAC name | [(3S,4S,6R)-5-acetamido-4,6-diacetyloxy-3-hydroxyoxan-2-yl]methyl acetate |
| InChIKey | RCYLXESGSHGRBI-LSUUEXMVSA-N |
| SMILES | CC(=O)NC1[C@@H]([C@@H](C(O[C@@H]1OC(=O)C)COC(=O)C)O)OC(=O)C |
Computed by PubChem (NCBI)