CAS 58484-22-3 is the registry number for 2,3,4,6-Tetra-O-acetyl-Beta-D-galactopyranosylamine, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 2,5g, 250mg.
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-aminooxan-2-yl]methyl acetate (CAS 58484-22-3) is a chemical compound with the molecular formula C14H21NO9 and a molecular weight of 347.32 g/mol. IUPAC name: [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-aminooxan-2-yl]methyl acetate. InChIKey: LMVYBLMOENOGGK-MBJXGIAVSA-N.
| Molecular formula | C14H21NO9 |
|---|---|
| Molecular weight | 347.32 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-aminooxan-2-yl]methyl acetate |
| InChIKey | LMVYBLMOENOGGK-MBJXGIAVSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)N)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)