CAS 7304-72-5 appears in our catalog under these names: tert-Butyl 2-chloro-3-oxobutanoate, 95%, tert-Butyl 2-chloro-3-oxobutanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl 2-chloro-3-oxobutanoate (CAS 7304-72-5) is a chemical compound with the molecular formula C8H13ClO3 and a molecular weight of 192.64 g/mol. IUPAC name: tert-butyl 2-chloro-3-oxobutanoate. InChIKey: ZTHHPFWQCBJKDK-UHFFFAOYSA-N.
| Molecular formula | C8H13ClO3 |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | tert-butyl 2-chloro-3-oxobutanoate |
| InChIKey | ZTHHPFWQCBJKDK-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C(=O)OC(C)(C)C)Cl |
Computed by PubChem (NCBI)