CAS 82736-39-8 is the registry number for cis-3-Acetoxy-6-chlorocyclohexene. Offered by: TRC. Available pack sizes: 500mg.
Acetic acid;(1S,4R)-4-chlorocyclohex-2-en-1-ol (CAS 82736-39-8) is a chemical compound with the molecular formula C8H13ClO3 and a molecular weight of 192.64 g/mol. IUPAC name: acetic acid;(1S,4R)-4-chlorocyclohex-2-en-1-ol. InChIKey: KIHLISCJPVOTJW-RIHPBJNCSA-N.
| Molecular formula | C8H13ClO3 |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | acetic acid;(1S,4R)-4-chlorocyclohex-2-en-1-ol |
| InChIKey | KIHLISCJPVOTJW-RIHPBJNCSA-N |
| SMILES | CC(=O)O.C1C[C@H](C=C[C@H]1O)Cl |
Computed by PubChem (NCBI)