CAS 859082-28-3 is the registry number for 4-chloro-3,3-dimethyl-4-oxobutan-2-yl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-chloro-3,3-dimethyl-4-oxobutan-2-yl) acetate (CAS 859082-28-3) is a chemical compound with the molecular formula C8H13ClO3 and a molecular weight of 192.64 g/mol. IUPAC name: (4-chloro-3,3-dimethyl-4-oxobutan-2-yl) acetate. InChIKey: XLBCEDVQTOFYCL-UHFFFAOYSA-N.
| Molecular formula | C8H13ClO3 |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | (4-chloro-3,3-dimethyl-4-oxobutan-2-yl) acetate |
| InChIKey | XLBCEDVQTOFYCL-UHFFFAOYSA-N |
| SMILES | CC(C(C)(C)C(=O)Cl)OC(=O)C |
Computed by PubChem (NCBI)