Products 7309-52-6
CAS 7309-52-6 appears in our catalog under these names: 2-(3-Methoxyphenoxy)propanoic acid, 98%, 2-(3-Methoxyphenoxy)propanoic acid, >95% (HPLC), 2–(3–Methoxyphenoxy)propionic Acid, 2-(3-Methoxy-phenoxy)-propionic acid, 2-(3-Methoxyphenoxy)propionic Acid 97%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 10g, 5g, 1g, 25g, 100mg, 500mg, 250mg.
2-(3-methoxyphenoxy)propanoic acid (CAS 7309-52-6) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: 2-(3-methoxyphenoxy)propanoic acid. InChIKey: QAVOEPJGKZAZIG-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 2-(3-methoxyphenoxy)propanoic acid |
| InChIKey | QAVOEPJGKZAZIG-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=CC=CC(=C1)OC |
Computed by PubChem (NCBI)