CAS 731-48-6 is the registry number for 2-Cyano-3,3-diphenyl-2-propenamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-cyano-3,3-diphenylprop-2-enamide (CAS 731-48-6) is a chemical compound with the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. IUPAC name: 2-cyano-3,3-diphenylprop-2-enamide. InChIKey: XPQBSIDNBUQWRU-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 2-cyano-3,3-diphenylprop-2-enamide |
| InChIKey | XPQBSIDNBUQWRU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C#N)C(=O)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)