CAS 7323-63-9 appears in our catalog under these names: 1,4–Di–tert–butyl–2,5–dimethoxybenzene, 1,4-Di-tert-butyl-2,5-dimethoxybenzene, >98.0%(GC), 1,4-Di-tert-butyl-2,5-dimethoxybenzene, 98%, 98%, 1,4-Di-tert-butyl-2,5-dimethoxybenzene, 95%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 250mg, 1g, 5g, 10g, 250g, 500g.
1,4-ditert-butyl-2,5-dimethoxybenzene (CAS 7323-63-9) is a chemical compound with the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. IUPAC name: 1,4-ditert-butyl-2,5-dimethoxybenzene. InChIKey: ATGCJUULFWEWPY-UHFFFAOYSA-N.
| Molecular formula | C16H26O2 |
|---|---|
| Molecular weight | 250.38 g/mol |
| IUPAC name | 1,4-ditert-butyl-2,5-dimethoxybenzene |
| InChIKey | ATGCJUULFWEWPY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1OC)C(C)(C)C)OC |
Computed by PubChem (NCBI)