CAS 73246-30-7 appears in our catalog under these names: H-Tyr-(3,5-DiF)-OH, 97%, 3,5-Difluoro-L-tyrosine, 3,5–Difluoro–L–tyrosine, 3,5-Difluoro-L-tyrosine, 97%, 97%, 3,5-Difluoro-L-tyrosine, 98.39%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 5mg, 10mg, 25mg, 100mg, 50mg, 500mg, 250mg.
(2S)-2-amino-3-(3,5-difluoro-4-hydroxyphenyl)propanoic acid (CAS 73246-30-7) is a chemical compound with the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. IUPAC name: (2S)-2-amino-3-(3,5-difluoro-4-hydroxyphenyl)propanoic acid. InChIKey: KPKMCRFCNWVLDA-ZETCQYMHSA-N.
| Molecular formula | C9H9F2NO3 |
|---|---|
| Molecular weight | 217.17 g/mol |
| IUPAC name | (2S)-2-amino-3-(3,5-difluoro-4-hydroxyphenyl)propanoic acid |
| InChIKey | KPKMCRFCNWVLDA-ZETCQYMHSA-N |
| SMILES | C1=C(C=C(C(=C1F)O)F)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)