Products 73256-82-3
CAS 73256-82-3 is the registry number for (-)-Isobicyclogermacrenal. Offered by: MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg.
(1R,2E,6E,10S)-7,11,11-trimethylbicyclo[8.1.0]undeca-2,6-diene-3-carbaldehyde (CAS 73256-82-3) is a chemical compound with the molecular formula C15H22O and a molecular weight of 218.33 g/mol. IUPAC name: (1R,2E,6E,10S)-7,11,11-trimethylbicyclo[8.1.0]undeca-2,6-diene-3-carbaldehyde. InChIKey: BLCUVJCHWZPQCX-UMDNKZHUSA-N.
| Molecular formula | C15H22O |
|---|---|
| Molecular weight | 218.33 g/mol |
| IUPAC name | (1R,2E,6E,10S)-7,11,11-trimethylbicyclo[8.1.0]undeca-2,6-diene-3-carbaldehyde |
| InChIKey | BLCUVJCHWZPQCX-UMDNKZHUSA-N |
| SMILES | C/C/1=C\CC/C(=C\[C@@H]2[C@@H](C2(C)C)CC1)/C=O |
Computed by PubChem (NCBI)