CAS 733762-51-1 is the registry number for 3-(Benzyl(phenyl)sulfamoyl)-4-chlorobenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[benzyl(phenyl)sulfamoyl]-4-chlorobenzoic acid (CAS 733762-51-1) is a chemical compound with the molecular formula C20H16ClNO4S and a molecular weight of 401.9 g/mol. IUPAC name: 3-[benzyl(phenyl)sulfamoyl]-4-chlorobenzoic acid. InChIKey: ZSPOVVBXTNJMRN-UHFFFAOYSA-N.
| Molecular formula | C20H16ClNO4S |
|---|---|
| Molecular weight | 401.9 g/mol |
| IUPAC name | 3-[benzyl(phenyl)sulfamoyl]-4-chlorobenzoic acid |
| InChIKey | ZSPOVVBXTNJMRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(C2=CC=CC=C2)S(=O)(=O)C3=C(C=CC(=C3)C(=O)O)Cl |
Computed by PubChem (NCBI)