Products 750613-52-6
CAS 750613-52-6 appears in our catalog under these names: 3-[Benzyl-(2-chloro-phenyl)-sulfamoyl]-benzoic acid, 95%, 3-(Benzyl(2-chlorophenyl)sulfamoyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-[benzyl-(2-chlorophenyl)sulfamoyl]benzoic acid (CAS 750613-52-6) is a chemical compound with the molecular formula C20H16ClNO4S and a molecular weight of 401.9 g/mol. IUPAC name: 3-[benzyl-(2-chlorophenyl)sulfamoyl]benzoic acid. InChIKey: MXTUBBUJFYQJBL-UHFFFAOYSA-N.
| Molecular formula | C20H16ClNO4S |
|---|---|
| Molecular weight | 401.9 g/mol |
| IUPAC name | 3-[benzyl-(2-chlorophenyl)sulfamoyl]benzoic acid |
| InChIKey | MXTUBBUJFYQJBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(C2=CC=CC=C2Cl)S(=O)(=O)C3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)