CAS 885269-34-1 appears in our catalog under these names: 4-(([(4'-Chloro[1,1'-biphenyl]-4-yl)sulfonyl]amino)methyl)benzoic acid, 95%, 4-(((4'-Chloro-[1,1'-biphenyl])-4-sulfonamido)methyl)benzoic acid, 97%, 97%, 4-(((4'-Chloro-[1,1'-biphenyl])-4-sulfonamido)methyl)benzoic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 5g, 1g, 100mg.
4-[[[4-(4-chlorophenyl)phenyl]sulfonylamino]methyl]benzoic acid (CAS 885269-34-1) is a chemical compound with the molecular formula C20H16ClNO4S and a molecular weight of 401.9 g/mol. IUPAC name: 4-[[[4-(4-chlorophenyl)phenyl]sulfonylamino]methyl]benzoic acid. InChIKey: GUQRJHKGQSZKRY-UHFFFAOYSA-N.
| Molecular formula | C20H16ClNO4S |
|---|---|
| Molecular weight | 401.9 g/mol |
| IUPAC name | 4-[[[4-(4-chlorophenyl)phenyl]sulfonylamino]methyl]benzoic acid |
| InChIKey | GUQRJHKGQSZKRY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNS(=O)(=O)C2=CC=C(C=C2)C3=CC=C(C=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)