CAS 733796-08-2 is the registry number for 4-(Difluoromethoxy)-3-methoxybenzaldehyde oxime. Offered by: Biosynth. Available pack sizes: 2,5g.
(NE)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]hydroxylamine (CAS 733796-08-2) is a chemical compound with the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. IUPAC name: (NE)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]hydroxylamine. InChIKey: ZBRAYHQANBMXJA-LFYBBSHMSA-N.
| Molecular formula | C9H9F2NO3 |
|---|---|
| Molecular weight | 217.17 g/mol |
| IUPAC name | (NE)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]hydroxylamine |
| InChIKey | ZBRAYHQANBMXJA-LFYBBSHMSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=N/O)OC(F)F |
Computed by PubChem (NCBI)