CAS 73392-01-5 is the registry number for 1-(Bromoacetyl)indoline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-bromo-1-(2,3-dihydroindol-1-yl)ethanone (CAS 73392-01-5) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 2-bromo-1-(2,3-dihydroindol-1-yl)ethanone. InChIKey: NCHBDJXOHMIGRE-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 2-bromo-1-(2,3-dihydroindol-1-yl)ethanone |
| InChIKey | NCHBDJXOHMIGRE-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C(=O)CBr |
Computed by PubChem (NCBI)