Products 73486-85-8
CAS 73486-85-8 appears in our catalog under these names: Chlorphenamine Impurity 41, Chlorphenamine Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-chlorophenyl)-3-pyridin-2-ylpropan-1-ol (CAS 73486-85-8) is a chemical compound with the molecular formula C14H14ClNO and a molecular weight of 247.72 g/mol. IUPAC name: 3-(4-chlorophenyl)-3-pyridin-2-ylpropan-1-ol. InChIKey: GHMGPTKYGKJQEU-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO |
|---|---|
| Molecular weight | 247.72 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-3-pyridin-2-ylpropan-1-ol |
| InChIKey | GHMGPTKYGKJQEU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(CCO)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
3-(p-Chlorophenyl)-3-(2-pyridyl)propanol, 3-(p-Chlorophenyl)-3-(2-pyridyl)-propyl alcohol, 2-Pyridinepropanol, gamma-(4-chlorophenyl)-, 2-Pyridinepropanol, gamma-(p-chlorophenyl)-, 3-(4-chlorophenyl)-3-pyridin-2-ylpropan-1-ol, Chlorphenamine Impurity 41, Oprea1_685188, 3-(4-chlorophenyl)-3-(pyridin-2-yl)propan-1-ol