CAS 893754-21-7 appears in our catalog under these names: 3-Chloro-4-(2,5-dimethylphenoxy)aniline, 97%, 3-Chloro-4-(2,5-dimethylphenoxy)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
3-chloro-4-(2,5-dimethylphenoxy)aniline (CAS 893754-21-7) is a chemical compound with the molecular formula C14H14ClNO and a molecular weight of 247.72 g/mol. IUPAC name: 3-chloro-4-(2,5-dimethylphenoxy)aniline. InChIKey: XEMUBLNKRNLDBO-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO |
|---|---|
| Molecular weight | 247.72 g/mol |
| IUPAC name | 3-chloro-4-(2,5-dimethylphenoxy)aniline |
| InChIKey | XEMUBLNKRNLDBO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)OC2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)