CAS 84865-95-2 is the registry number for 3-Chloro-4-(3,4-dimethylphenoxy)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-chloro-4-(3,4-dimethylphenoxy)aniline (CAS 84865-95-2) is a chemical compound with the molecular formula C14H14ClNO and a molecular weight of 247.72 g/mol. IUPAC name: 3-chloro-4-(3,4-dimethylphenoxy)aniline. InChIKey: BMCARPLEMPBICF-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO |
|---|---|
| Molecular weight | 247.72 g/mol |
| IUPAC name | 3-chloro-4-(3,4-dimethylphenoxy)aniline |
| InChIKey | BMCARPLEMPBICF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC2=C(C=C(C=C2)N)Cl)C |
Computed by PubChem (NCBI)