Products 73579-45-0
CAS 73579-45-0 is the registry number for L-Leucine-18O2, 98%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 100 mg, 5 mg, 25 mg, 10 mg.
(2S)-2-amino-4-methylpentan(18O2)oic acid (CAS 73579-45-0) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 135.17 g/mol. IUPAC name: (2S)-2-amino-4-methylpentan(18O2)oic acid. InChIKey: ROHFNLRQFUQHCH-RFYFGWGDSA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 135.17 g/mol |
| IUPAC name | (2S)-2-amino-4-methylpentan(18O2)oic acid |
| InChIKey | ROHFNLRQFUQHCH-RFYFGWGDSA-N |
| SMILES | CC(C)C[C@@H](C(=[18O])[18OH])N |
Computed by PubChem (NCBI)
Synonyms:
L-Leucine-18O2, L-Leucine-