CAS 73631-58-0 appears in our catalog under these names: Glipizide Impurity 19, Glipizide Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2-aminoethyl)benzenesulfonic acid (CAS 73631-58-0) is a chemical compound with the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. IUPAC name: 4-(2-aminoethyl)benzenesulfonic acid. InChIKey: RYBFWJVHZIKGQJ-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 4-(2-aminoethyl)benzenesulfonic acid |
| InChIKey | RYBFWJVHZIKGQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCN)S(=O)(=O)O |
Computed by PubChem (NCBI)