CAS 73660-93-2 appears in our catalog under these names: Noradrenaline (Norepinephrine) Impurity 25, Norepinephrine Impurity 12 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-amino-1-hydroxyethyl)benzene-1,2-diol (CAS 73660-93-2) is a chemical compound with the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. IUPAC name: 3-(2-amino-1-hydroxyethyl)benzene-1,2-diol. InChIKey: NAAQLEYZJPJQEG-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 3-(2-amino-1-hydroxyethyl)benzene-1,2-diol |
| InChIKey | NAAQLEYZJPJQEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)O)C(CN)O |
Computed by PubChem (NCBI)