CAS 736948-97-3 appears in our catalog under these names: 3-Chloro-5-ethoxy-4-methoxybenzaldehyde, 3-Chloro-5-ethoxy-4-methoxybenzaldehyde, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 10g, 1g, 250mg.
3-chloro-5-ethoxy-4-methoxybenzaldehyde (CAS 736948-97-3) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 214.64 g/mol. IUPAC name: 3-chloro-5-ethoxy-4-methoxybenzaldehyde. InChIKey: KBTYBYHNPJXGES-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3 |
|---|---|
| Molecular weight | 214.64 g/mol |
| IUPAC name | 3-chloro-5-ethoxy-4-methoxybenzaldehyde |
| InChIKey | KBTYBYHNPJXGES-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C=O)Cl)OC |
Computed by PubChem (NCBI)