Products 73739-94-3

CAS 73739-94-3 is the registry number for Methyl 2-(3,5-dimethylphenyl)acetate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-(3,5-dimethylphenyl)acetate (CAS 73739-94-3) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: methyl 2-(3,5-dimethylphenyl)acetate. InChIKey: LUGVRYYQNXFPDM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O2
Molecular weight178.23 g/mol
IUPAC namemethyl 2-(3,5-dimethylphenyl)acetate
InChIKeyLUGVRYYQNXFPDM-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1)CC(=O)OC)C

Computed by PubChem (NCBI)