CAS 73739-94-3 is the registry number for Methyl 2-(3,5-dimethylphenyl)acetate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Methyl 2-(3,5-dimethylphenyl)acetate (CAS 73739-94-3) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: methyl 2-(3,5-dimethylphenyl)acetate. InChIKey: LUGVRYYQNXFPDM-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | methyl 2-(3,5-dimethylphenyl)acetate |
| InChIKey | LUGVRYYQNXFPDM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)CC(=O)OC)C |
Computed by PubChem (NCBI)