CAS 73790-06-4 appears in our catalog under these names: Ethyl oxo (4-trifluoromethylphenyl) acetate, Ethyl oxo-(4-trifluoromethylphenyl)acetate, 95%, Ethyl 2-oxo-2-(4-(trifluoromethyl)phenyl)acetate, 94%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 2,5g, 1g, 250mg, 5g.
Ethyl 2-oxo-2-[4-(trifluoromethyl)phenyl]acetate (CAS 73790-06-4) is a chemical compound with the molecular formula C11H9F3O3 and a molecular weight of 246.18 g/mol. IUPAC name: ethyl 2-oxo-2-[4-(trifluoromethyl)phenyl]acetate. InChIKey: GWZHQTZYBBUMHI-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O3 |
|---|---|
| Molecular weight | 246.18 g/mol |
| IUPAC name | ethyl 2-oxo-2-[4-(trifluoromethyl)phenyl]acetate |
| InChIKey | GWZHQTZYBBUMHI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)