CAS 73804-69-0 appears in our catalog under these names: (1R,2R,5S)-Rel-3-azabicyclo[3.1.0]hexane-2-carboxylic acid, hydrochloride, 95%, (1R,2R,5S)-3-Azabicyclo(3.1.0)hexane-2-carboxylic acid hydrochloride, 97%, (1R,2R,5S)-3-Azabicyclo[3.1.0]hexane-2-carboxylic acid hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 25g, 100mg, 500mg, 1g, 5g.
(1S,2S,5R)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid;hydrochloride (CAS 73804-69-0) is a chemical compound with the molecular formula C6H10ClNO2 and a molecular weight of 163.60 g/mol. IUPAC name: (1S,2S,5R)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid;hydrochloride. InChIKey: KWBHCTGCOVQKMK-SHLRHQAISA-N.
| Molecular formula | C6H10ClNO2 |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | (1S,2S,5R)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid;hydrochloride |
| InChIKey | KWBHCTGCOVQKMK-SHLRHQAISA-N |
| SMILES | C1[C@@H]2[C@H]1[C@H](NC2)C(=O)O.Cl |
Computed by PubChem (NCBI)