CAS 7387-57-7 appears in our catalog under these names: 2’,3’,5’-Tri-O-acetyladenosine, >95% (HPLC), 2',3',5'–Tri–O–acetyl adenosine, 2',3',5'-Tri-O-acetyladenosine, 2’,3’,5’-Tri-O-acetyl adenosine 98%, (2R,3R,4R,5R)-2-(Acetoxymethyl)-5-(6-amino-9H-purin-9-yl)tetrahydrofuran-3,4-diyl diacetate, 98%, 98%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 100g, 25g, 1000mg, 500mg, 5g, 500g, 15g.
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl acetate (CAS 7387-57-7) is a chemical compound with the molecular formula C16H19N5O7 and a molecular weight of 393.35 g/mol. IUPAC name: [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl acetate. InChIKey: GCVZNVTXNUTBFB-XNIJJKJLSA-N.
| Molecular formula | C16H19N5O7 |
|---|---|
| Molecular weight | 393.35 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl acetate |
| InChIKey | GCVZNVTXNUTBFB-XNIJJKJLSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)