CAS 73913-48-1 is the registry number for Deoxy Ketoprofen. Offered by: TRC. Available pack sizes: 10mg.
2-(3-benzylphenyl)propanoic acid (CAS 73913-48-1) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: 2-(3-benzylphenyl)propanoic acid. InChIKey: RYYYTOGKTKBJDJ-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 2-(3-benzylphenyl)propanoic acid |
| InChIKey | RYYYTOGKTKBJDJ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC(=C1)CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)