Products 739365-07-2
CAS 739365-07-2 appears in our catalog under these names: 6–Methoxy–1–methyl–1H–indole–2–carboxylic acid, 6-Methoxy-1-methyl-1h-indole-2-carboxylic acid, 98%, 98%, 6-Methoxy-1-methyl-1h-indole-2-carboxylic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-methoxy-1-methylindole-2-carboxylic acid (CAS 739365-07-2) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 6-methoxy-1-methylindole-2-carboxylic acid. InChIKey: KXACSDHQSUBYNG-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 6-methoxy-1-methylindole-2-carboxylic acid |
| InChIKey | KXACSDHQSUBYNG-UHFFFAOYSA-N |
| SMILES | CN1C(=CC2=C1C=C(C=C2)OC)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
6-Methoxy-1-methyl-1H-indole-2-carboxylic acid, 6-methoxy-1-methylindole-2-carboxylic acid, 1H-indole-2-carboxylic acid, 6-methoxy-1-methyl-, 6-methoxy-1-methyl-indole-2-carboxylic acid, 6-methoxy-1-methyl-2-indolecarboxylic acid, 6-methoxy-1-methyl-1H-indole-2-carboxylic acid(SALTDATA: FREE)