Products 7398-52-9
CAS 7398-52-9 appears in our catalog under these names: (4-Acetylphenyl)acetic acid, 95%, 2–(4–Acetylphenyl)acetic acid, 4-Acetylphenylacetic acid, 2-(4-Acetylphenyl)acetic acid 98%, 2-(4-Acetylphenyl)acetic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
2-(4-acetylphenyl)acetic acid (CAS 7398-52-9) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 2-(4-acetylphenyl)acetic acid. InChIKey: DQGDHZGCMKDNRW-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 2-(4-acetylphenyl)acetic acid |
| InChIKey | DQGDHZGCMKDNRW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)CC(=O)O |
Computed by PubChem (NCBI)