Products 772337-53-8
CAS 772337-53-8 is the registry number for (1R,2S)-1-Amino-N-(cyclopropylsulfonyl)-2-vinylcyclopropanecarboxamide, 97% mix TBC as stabilizer. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2S)-1-amino-N-cyclopropylsulfonyl-2-ethenylcyclopropane-1-carboxamide (CAS 772337-53-8) is a chemical compound with the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. IUPAC name: trans-(1R,2S)-1-amino-N-cyclopropylsulfonyl-2-ethenylcyclopropane-1-carboxamide. InChIKey: VGHBWKACJXNKAF-HZGVNTEJSA-N.
| Molecular formula | C9H14N2O3S |
|---|---|
| Molecular weight | 230.29 g/mol |
| IUPAC name | trans-(1R,2S)-1-amino-N-cyclopropylsulfonyl-2-ethenylcyclopropane-1-carboxamide |
| InChIKey | VGHBWKACJXNKAF-HZGVNTEJSA-N |
| SMILES | C=C[C@@H]1C[C@@]1(C(=O)NS(=O)(=O)C2CC2)N |
Computed by PubChem (NCBI)