CAS 936361-33-0 appears in our catalog under these names: 4-Amino-2-methoxy-N,N-dimethylbenzene-1-sulfonamide, 95%, 4-Amino-2-methoxy-N,N-dimethylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-amino-2-methoxy-N,N-dimethylbenzenesulfonamide (CAS 936361-33-0) is a chemical compound with the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. IUPAC name: 4-amino-2-methoxy-N,N-dimethylbenzenesulfonamide. InChIKey: QFUHGAYWBVJFIS-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3S |
|---|---|
| Molecular weight | 230.29 g/mol |
| IUPAC name | 4-amino-2-methoxy-N,N-dimethylbenzenesulfonamide |
| InChIKey | QFUHGAYWBVJFIS-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(C=C(C=C1)N)OC |
Computed by PubChem (NCBI)