Products 74134-89-7
CAS 74134-89-7 appears in our catalog under these names: D-Galactose-13C6, >95% (HPLC), D–Galactose–13C6, D-Galactose-13C6, 98.0%, 98.0%, D-Galactose-13C6, 99.0%. Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 50mg, 5mg, 10mg, 10 mg, 5 mg.
(2S,3R,4S,5S,6R)-6-(hydroxy(113C)methyl)(2,3,4,5,6-13C5)oxane-2,3,4,5-tetrol (CAS 74134-89-7) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 186.11 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-6-(hydroxy(113C)methyl)(2,3,4,5,6-13C5)oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-YPYOLYKNSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 186.11 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-6-(hydroxy(113C)methyl)(2,3,4,5,6-13C5)oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-YPYOLYKNSA-N |
| SMILES | [13CH2]([13C@@H]1[13C@H]([13C@@H]([13C@H]([13C@H](O1)O)O)O)O)O |
Computed by PubChem (NCBI)