CAS 741717-59-9 appears in our catalog under these names: 2–(1–Pyrazolyl)benzyl Alcohol, 2-(1-Pyrazolyl)benzyl Alcohol 95%, [2-(1H-Pyrazol-1-yl)phenyl]methanol, 95%, 95%, 2-(1-Pyrazolyl)benzyl Alcohol, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
(2-pyrazol-1-ylphenyl)methanol (CAS 741717-59-9) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: (2-pyrazol-1-ylphenyl)methanol. InChIKey: HDACOBLOISVBLA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | (2-pyrazol-1-ylphenyl)methanol |
| InChIKey | HDACOBLOISVBLA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CO)N2C=CC=N2 |
Computed by PubChem (NCBI)