CAS 74192-47-5 appears in our catalog under these names: 4-Amino-3-cyanobenzoic acid, 95%, 95%, 4-Amino-3-cyanobenzoic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
4-amino-3-cyanobenzoic acid (CAS 74192-47-5) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 4-amino-3-cyanobenzoic acid. InChIKey: SCDUHKOJSMYVPO-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 4-amino-3-cyanobenzoic acid |
| InChIKey | SCDUHKOJSMYVPO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C#N)N |
Computed by PubChem (NCBI)