Products 742109-29-1
CAS 742109-29-1 is the registry number for 2-(Benzyl(methyl)amino)-2-oxoethyl-3-(5-bromofuran-2-yl)acrylate, 98%. Offered by: Fluorochem. Available pack sizes: 10mg.
[2-[benzyl(methyl)amino]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate (CAS 742109-29-1) is a chemical compound with the molecular formula C17H16BrNO4 and a molecular weight of 378.2 g/mol. IUPAC name: [2-[benzyl(methyl)amino]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate. InChIKey: IIZZNRKDPNHDQH-CSKARUKUSA-N.
| Molecular formula | C17H16BrNO4 |
|---|---|
| Molecular weight | 378.2 g/mol |
| IUPAC name | [2-[benzyl(methyl)amino]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| InChIKey | IIZZNRKDPNHDQH-CSKARUKUSA-N |
| SMILES | CN(CC1=CC=CC=C1)C(=O)COC(=O)/C=C/C2=CC=C(O2)Br |
Computed by PubChem (NCBI)