CAS 74229-76-8 is the registry number for N-Hydroxy-4-methyl-3-nitrobenzimidamide, 98%. Offered by: AmBeed. Available pack sizes: 5g.
N'-hydroxy-4-methyl-3-nitrobenzenecarboximidamide (CAS 74229-76-8) is a chemical compound with the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. IUPAC name: N'-hydroxy-4-methyl-3-nitrobenzenecarboximidamide. InChIKey: LYAOQDSZXTXCHL-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O3 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | N'-hydroxy-4-methyl-3-nitrobenzenecarboximidamide |
| InChIKey | LYAOQDSZXTXCHL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)/C(=N/O)/N)[N+](=O)[O-] |
Computed by PubChem (NCBI)