Products 7423-42-9
CAS 7423-42-9 appears in our catalog under these names: Docusate Impurity 2, 2-Ethylhexyl Maleate, (Z)-4-((2-Ethylhexyl)oxy)-4-oxobut-2-enoic acid 95%, 2-Ethylhexyl Maleate, 95%, 95%. Offered by: Chemat Brand, TRC, Ambeed, Chemat. Available pack sizes: on request, 2,5g, 5g, 25g, 100g, 1g.
(Z)-4-(2-ethylhexoxy)-4-oxobut-2-enoic acid (CAS 7423-42-9) is a chemical compound with the molecular formula C12H20O4 and a molecular weight of 228.28 g/mol. IUPAC name: (Z)-4-(2-ethylhexoxy)-4-oxobut-2-enoic acid. InChIKey: IQBLWPLYPNOTJC-FPLPWBNLSA-N.
| Molecular formula | C12H20O4 |
|---|---|
| Molecular weight | 228.28 g/mol |
| IUPAC name | (Z)-4-(2-ethylhexoxy)-4-oxobut-2-enoic acid |
| InChIKey | IQBLWPLYPNOTJC-FPLPWBNLSA-N |
| SMILES | CCCCC(CC)COC(=O)/C=C\C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Monooctyl Maleate, 2-Ethylhexyl hydrogen maleate, Mono(2-ethylhexyl) Maleate, Mono(2-ethylhexyl)maleate, 2-Ethylhexyl maleate, 2-Butenedioic acid (Z)-, mono(2-ethylhexyl) ester, 2-Butenedioic acid (2Z)-, 1-(2-ethylhexyl) ester, 2-Butenedioic acid (2Z)-, mono(2-ethylhexyl) ester, (Z)-4-((2-Ethylhexyl)oxy)-4-oxobut-2-enoic acid, (Z)-4-(2-ethylhexoxy)-4-oxobut-2-enoic acid