Products 74248-92-3
CAS 74248-92-3 is the registry number for LY-79771 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(3S)-3-[[(2R)-2-hydroxy-2-phenylethyl]amino]butyl]phenol;hydrochloride (CAS 74248-92-3) is a chemical compound with the molecular formula C18H24ClNO2 and a molecular weight of 321.8 g/mol. IUPAC name: 4-[(3S)-3-[[(2R)-2-hydroxy-2-phenylethyl]amino]butyl]phenol;hydrochloride. InChIKey: SBGSKJIIRMOMTL-DJKAKHFESA-N.
| Molecular formula | C18H24ClNO2 |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | 4-[(3S)-3-[[(2R)-2-hydroxy-2-phenylethyl]amino]butyl]phenol;hydrochloride |
| InChIKey | SBGSKJIIRMOMTL-DJKAKHFESA-N |
| SMILES | C[C@@H](CCC1=CC=C(C=C1)O)NC[C@@H](C2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)