Products 74302-64-0
CAS 74302-64-0 is the registry number for 2-(1-Aminoethyl)-4-bromophenol hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1-aminoethyl)-4-bromophenol;hydrochloride (CAS 74302-64-0) is a chemical compound with the molecular formula C8H11BrClNO and a molecular weight of 252.53 g/mol. IUPAC name: 2-(1-aminoethyl)-4-bromophenol;hydrochloride. InChIKey: LZBNTJQCHNZXFB-UHFFFAOYSA-N.
| Molecular formula | C8H11BrClNO |
|---|---|
| Molecular weight | 252.53 g/mol |
| IUPAC name | 2-(1-aminoethyl)-4-bromophenol;hydrochloride |
| InChIKey | LZBNTJQCHNZXFB-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC(=C1)Br)O)N.Cl |
Computed by PubChem (NCBI)