CAS 7434-77-7 is the registry number for 3,5-Diiodo-Alpha-methyl-DL-tyrosine. Offered by: TRC. Available pack sizes: 10g, 1g.
2-amino-3-(4-hydroxy-3,5-diiodophenyl)-2-methylpropanoic acid (CAS 7434-77-7) is a chemical compound with the molecular formula C10H11I2NO3 and a molecular weight of 447.01 g/mol. IUPAC name: 2-amino-3-(4-hydroxy-3,5-diiodophenyl)-2-methylpropanoic acid. InChIKey: PXCMIGZYZKLYAA-UHFFFAOYSA-N.
| Molecular formula | C10H11I2NO3 |
|---|---|
| Molecular weight | 447.01 g/mol |
| IUPAC name | 2-amino-3-(4-hydroxy-3,5-diiodophenyl)-2-methylpropanoic acid |
| InChIKey | PXCMIGZYZKLYAA-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C(=C1)I)O)I)(C(=O)O)N |
Computed by PubChem (NCBI)