Products 743420-65-7
CAS 743420-65-7 is the registry number for 4H-Cyclopenta[g]quinazolin-4-one, 2-amino-1,6,7,8-tetrahydro-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-amino-3,6,7,8-tetrahydrocyclopenta[g]quinazolin-4-one (CAS 743420-65-7) is a chemical compound with the molecular formula C11H11N3O and a molecular weight of 201.22 g/mol. IUPAC name: 2-amino-3,6,7,8-tetrahydrocyclopenta[g]quinazolin-4-one. InChIKey: QQCUANWKXAIRAT-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 2-amino-3,6,7,8-tetrahydrocyclopenta[g]quinazolin-4-one |
| InChIKey | QQCUANWKXAIRAT-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(C=C2C1)N=C(NC3=O)N |
Computed by PubChem (NCBI)