Products 743430-91-3
CAS 743430-91-3 is the registry number for 2-(6-Fluoro-1,3-benzodioxol-5-yl)ethanamine. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg.
2-(6-fluoro-1,3-benzodioxol-5-yl)ethanamine (CAS 743430-91-3) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: 2-(6-fluoro-1,3-benzodioxol-5-yl)ethanamine. InChIKey: KIEFVALLYIAFKF-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | 2-(6-fluoro-1,3-benzodioxol-5-yl)ethanamine |
| InChIKey | KIEFVALLYIAFKF-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)CCN)F |
Computed by PubChem (NCBI)